C26H27F3O4S — CID 10648834
(2S,3S,4Z)-3-(benzenesulfonyl)-4-benzylidene-3-(3,3-dimethylbut-1-ynyl)-2-ethoxy-2-(trifluoromethyl)oxolane (PubChem CID 10648834) has the molecular formula C26H27F3O4S and a molecular weight of 492.56 g/mol. Its IUPAC name is (2S,3S,4Z)-3-(benzenesulfonyl)-4-benzylidene-3-(3,3-dimethylbut-1-ynyl)-2-ethoxy-2-(trifluoromethyl)oxolane.
| Compound Name | (2S,3S,4Z)-3-(benzenesulfonyl)-4-benzylidene-3-(3,3-dimethylbut-1-ynyl)-2-ethoxy-2-(trifluoromethyl)oxolane |
|---|---|
| PubChem CID | 10648834 |
| Molecular Formula | C26H27F3O4S |
| Molecular Weight | 492.56 g/mol |
| Exact Mass | 492.16 |
| IUPAC Name | (2S,3S,4Z)-3-(benzenesulfonyl)-4-benzylidene-3-(3,3-dimethylbut-1-ynyl)-2-ethoxy-2-(trifluoromethyl)oxolane |
| SMILES | CCO[C@@]1(C(F)(F)F)OC/C(=C/c2ccccc2)[C@]1(C#CC(C)(C)C)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C26H27F3O4S/c1-5-32-25(26(27,28)29)24(17-16-23(2,3)4,34(30,31)22-14-10-7-11-15-22)21(19-33-25)18-20-12-8-6-9-13-20/h6-15,18H,5,19H2,1-4H3/b21-18-/t24-,25+/m0/s1 |
| InChIKey | WDEUSQDYKQOKOZ-AAUIVRIZSA-N |
| XLogP | 5.66 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.56 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|