C24H23F3O4S — CID 10647818
(2S,3S)-3-(benzenesulfonyl)-2-ethoxy-5,5-dimethyl-4-methylidene-3-(2-phenylethynyl)-2-(trifluoromethyl)oxolane (PubChem CID 10647818) has the molecular formula C24H23F3O4S and a molecular weight of 464.51 g/mol. Its IUPAC name is (2S,3S)-3-(benzenesulfonyl)-2-ethoxy-5,5-dimethyl-4-methylidene-3-(2-phenylethynyl)-2-(trifluoromethyl)oxolane.
| Compound Name | (2S,3S)-3-(benzenesulfonyl)-2-ethoxy-5,5-dimethyl-4-methylidene-3-(2-phenylethynyl)-2-(trifluoromethyl)oxolane |
|---|---|
| PubChem CID | 10647818 |
| Molecular Formula | C24H23F3O4S |
| Molecular Weight | 464.51 g/mol |
| Exact Mass | 464.13 |
| IUPAC Name | (2S,3S)-3-(benzenesulfonyl)-2-ethoxy-5,5-dimethyl-4-methylidene-3-(2-phenylethynyl)-2-(trifluoromethyl)oxolane |
| SMILES | C=C1C(C)(C)O[C@@](OCC)(C(F)(F)F)[C@@]1(C#Cc1ccccc1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C24H23F3O4S/c1-5-30-23(24(25,26)27)22(18(2)21(3,4)31-23,17-16-19-12-8-6-9-13-19)32(28,29)20-14-10-7-11-15-20/h6-15H,2,5H2,1,3-4H3/t22-,23+/m0/s1 |
| InChIKey | ZJHUXLOPLZLFJO-XZOQPEGZSA-N |
| XLogP | 4.91 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.51 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|