C22H27F3O4S — CID 10503448
4-(benzenesulfonylmethyl)-3-(3,3-dimethylbut-1-ynyl)-2-ethoxy-5,5-dimethyl-2-(trifluoromethyl)furan (PubChem CID 10503448) has the molecular formula C22H27F3O4S and a molecular weight of 444.52 g/mol. Its IUPAC name is 4-(benzenesulfonylmethyl)-3-(3,3-dimethylbut-1-ynyl)-2-ethoxy-5,5-dimethyl-2-(trifluoromethyl)furan.
| Compound Name | 4-(benzenesulfonylmethyl)-3-(3,3-dimethylbut-1-ynyl)-2-ethoxy-5,5-dimethyl-2-(trifluoromethyl)furan |
|---|---|
| PubChem CID | 10503448 |
| Molecular Formula | C22H27F3O4S |
| Molecular Weight | 444.52 g/mol |
| Exact Mass | 444.16 |
| IUPAC Name | 4-(benzenesulfonylmethyl)-3-(3,3-dimethylbut-1-ynyl)-2-ethoxy-5,5-dimethyl-2-(trifluoromethyl)furan |
| SMILES | CCOC1(C(F)(F)F)OC(C)(C)C(CS(=O)(=O)c2ccccc2)=C1C#CC(C)(C)C |
| InChI | InChI=1S/C22H27F3O4S/c1-7-28-21(22(23,24)25)17(13-14-19(2,3)4)18(20(5,6)29-21)15-30(26,27)16-11-9-8-10-12-16/h8-12H,7,15H2,1-6H3 |
| InChIKey | LFSNUYIHPLBUSF-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.52 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|