C22H27F3O4S — CID 10551269
(2S,3S)-3-(benzenesulfonyl)-3-(3,3-dimethylbut-1-ynyl)-2-ethoxy-5,5-dimethyl-4-methylidene-2-(trifluoromethyl)oxolane (PubChem CID 10551269) has the molecular formula C22H27F3O4S and a molecular weight of 444.52 g/mol. Its IUPAC name is (2S,3S)-3-(benzenesulfonyl)-3-(3,3-dimethylbut-1-ynyl)-2-ethoxy-5,5-dimethyl-4-methylidene-2-(trifluoromethyl)oxolane.
| Compound Name | (2S,3S)-3-(benzenesulfonyl)-3-(3,3-dimethylbut-1-ynyl)-2-ethoxy-5,5-dimethyl-4-methylidene-2-(trifluoromethyl)oxolane |
|---|---|
| PubChem CID | 10551269 |
| Molecular Formula | C22H27F3O4S |
| Molecular Weight | 444.52 g/mol |
| Exact Mass | 444.16 |
| IUPAC Name | (2S,3S)-3-(benzenesulfonyl)-3-(3,3-dimethylbut-1-ynyl)-2-ethoxy-5,5-dimethyl-4-methylidene-2-(trifluoromethyl)oxolane |
| SMILES | C=C1C(C)(C)O[C@@](OCC)(C(F)(F)F)[C@@]1(C#CC(C)(C)C)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C22H27F3O4S/c1-8-28-21(22(23,24)25)20(15-14-18(3,4)5,16(2)19(6,7)29-21)30(26,27)17-12-10-9-11-13-17/h9-13H,2,8H2,1,3-7H3/t20-,21+/m0/s1 |
| InChIKey | UBMFYUHRDADILJ-LEWJYISDSA-N |
| XLogP | 4.91 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.52 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|