C22H27F3O4S — CID 11797551
(2S,3S)-3-(benzenesulfonyl)-2-ethoxy-3-hex-1-ynyl-5,5-dimethyl-4-methylidene-2-(trifluoromethyl)oxolane (PubChem CID 11797551) has the molecular formula C22H27F3O4S and a molecular weight of 444.52 g/mol. Its IUPAC name is (2S,3S)-3-(benzenesulfonyl)-2-ethoxy-3-hex-1-ynyl-5,5-dimethyl-4-methylidene-2-(trifluoromethyl)oxolane.
| Compound Name | (2S,3S)-3-(benzenesulfonyl)-2-ethoxy-3-hex-1-ynyl-5,5-dimethyl-4-methylidene-2-(trifluoromethyl)oxolane |
|---|---|
| PubChem CID | 11797551 |
| Molecular Formula | C22H27F3O4S |
| Molecular Weight | 444.52 g/mol |
| Exact Mass | 444.16 |
| IUPAC Name | (2S,3S)-3-(benzenesulfonyl)-2-ethoxy-3-hex-1-ynyl-5,5-dimethyl-4-methylidene-2-(trifluoromethyl)oxolane |
| SMILES | C=C1C(C)(C)O[C@@](OCC)(C(F)(F)F)[C@@]1(C#CCCCC)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C22H27F3O4S/c1-6-8-9-13-16-20(30(26,27)18-14-11-10-12-15-18)17(3)19(4,5)29-21(20,28-7-2)22(23,24)25/h10-12,14-15H,3,6-9H2,1-2,4-5H3/t20-,21+/m0/s1 |
| InChIKey | MJYNVCOUCXUVHD-LEWJYISDSA-N |
| XLogP | 5.05 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.52 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|