C16H15F3O4S — CID 101011736
3-(benzenesulfonyl)-2-ethoxy-3-ethynyl-4-methylidene-2-(trifluoromethyl)oxolane (PubChem CID 101011736) has the molecular formula C16H15F3O4S and a molecular weight of 360.35 g/mol. Its IUPAC name is 3-(benzenesulfonyl)-2-ethoxy-3-ethynyl-4-methylidene-2-(trifluoromethyl)oxolane.
| Compound Name | 3-(benzenesulfonyl)-2-ethoxy-3-ethynyl-4-methylidene-2-(trifluoromethyl)oxolane |
|---|---|
| PubChem CID | 101011736 |
| Molecular Formula | C16H15F3O4S |
| Molecular Weight | 360.35 g/mol |
| Exact Mass | 360.06 |
| IUPAC Name | 3-(benzenesulfonyl)-2-ethoxy-3-ethynyl-4-methylidene-2-(trifluoromethyl)oxolane |
| SMILES | C#CC1(S(=O)(=O)c2ccccc2)C(=C)COC1(OCC)C(F)(F)F |
| InChI | InChI=1S/C16H15F3O4S/c1-4-14(24(20,21)13-9-7-6-8-10-13)12(3)11-23-15(14,22-5-2)16(17,18)19/h1,6-10H,3,5,11H2,2H3 |
| InChIKey | KZOFSXPWCWJGPI-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.35 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|