C25H31F3O4S — CID 10719663
(2S,3S)-3-(benzenesulfonyl)-2-ethoxy-3-hex-1-ynyl-4-methylidene-2-(trifluoromethyl)-1-oxaspiro[4.5]decane (PubChem CID 10719663) has the molecular formula C25H31F3O4S and a molecular weight of 484.58 g/mol. Its IUPAC name is (2S,3S)-3-(benzenesulfonyl)-2-ethoxy-3-hex-1-ynyl-4-methylidene-2-(trifluoromethyl)-1-oxaspiro[4.5]decane.
| Compound Name | (2S,3S)-3-(benzenesulfonyl)-2-ethoxy-3-hex-1-ynyl-4-methylidene-2-(trifluoromethyl)-1-oxaspiro[4.5]decane |
|---|---|
| PubChem CID | 10719663 |
| Molecular Formula | C25H31F3O4S |
| Molecular Weight | 484.58 g/mol |
| Exact Mass | 484.19 |
| IUPAC Name | (2S,3S)-3-(benzenesulfonyl)-2-ethoxy-3-hex-1-ynyl-4-methylidene-2-(trifluoromethyl)-1-oxaspiro[4.5]decane |
| SMILES | C=C1C2(CCCCC2)O[C@@](OCC)(C(F)(F)F)[C@@]1(C#CCCCC)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C25H31F3O4S/c1-4-6-7-14-19-23(33(29,30)21-15-10-8-11-16-21)20(3)22(17-12-9-13-18-22)32-24(23,31-5-2)25(26,27)28/h8,10-11,15-16H,3-7,9,12-13,17-18H2,1-2H3/t23-,24+/m0/s1 |
| InChIKey | MVXBSZBSAQCAJY-BJKOFHAPSA-N |
| XLogP | 5.98 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.58 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|