C24H44OSi3 — CID 10574782
[3-[(E)-2,4-bis(trimethylsilyl)but-1-en-3-ynyl]-2-cyclohexylcyclopenten-1-yl]oxy-trimethylsilane (PubChem CID 10574782) has the molecular formula C24H44OSi3 and a molecular weight of 432.87 g/mol. Its IUPAC name is [3-[(E)-2,4-bis(trimethylsilyl)but-1-en-3-ynyl]-2-cyclohexylcyclopenten-1-yl]oxy-trimethylsilane.
| Compound Name | [3-[(E)-2,4-bis(trimethylsilyl)but-1-en-3-ynyl]-2-cyclohexylcyclopenten-1-yl]oxy-trimethylsilane |
|---|---|
| PubChem CID | 10574782 |
| Molecular Formula | C24H44OSi3 |
| Molecular Weight | 432.87 g/mol |
| Exact Mass | 432.27 |
| IUPAC Name | [3-[(E)-2,4-bis(trimethylsilyl)but-1-en-3-ynyl]-2-cyclohexylcyclopenten-1-yl]oxy-trimethylsilane |
| SMILES | C[Si](C)(C)C#C/C(=C\C1CCC(O[Si](C)(C)C)=C1C1CCCCC1)[Si](C)(C)C |
| InChI | InChI=1S/C24H44OSi3/c1-26(2,3)18-17-22(27(4,5)6)19-21-15-16-23(25-28(7,8)9)24(21)20-13-11-10-12-14-20/h19-21H,10-16H2,1-9H3/b22-19+ |
| InChIKey | UVOQYXJMKCXKLR-ZBJSNUHESA-N |
| XLogP | 7.77 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.87 |
| LogP ≤ 5 | 7.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|