C25H25NO6 — CID 10598998
bis(prop-2-enyl) 2-[3-(4-carbamoylphenyl)-3-oxo-1-phenylpropyl]propanedioate (PubChem CID 10598998) has the molecular formula C25H25NO6 and a molecular weight of 435.48 g/mol. Its IUPAC name is bis(prop-2-enyl) 2-[3-(4-carbamoylphenyl)-3-oxo-1-phenylpropyl]propanedioate.
| Compound Name | bis(prop-2-enyl) 2-[3-(4-carbamoylphenyl)-3-oxo-1-phenylpropyl]propanedioate |
|---|---|
| PubChem CID | 10598998 |
| Molecular Formula | C25H25NO6 |
| Molecular Weight | 435.48 g/mol |
| Exact Mass | 435.17 |
| IUPAC Name | bis(prop-2-enyl) 2-[3-(4-carbamoylphenyl)-3-oxo-1-phenylpropyl]propanedioate |
| SMILES | C=CCOC(=O)C(C(=O)OCC=C)C(CC(=O)c1ccc(C(N)=O)cc1)c1ccccc1 |
| InChI | InChI=1S/C25H25NO6/c1-3-14-31-24(29)22(25(30)32-15-4-2)20(17-8-6-5-7-9-17)16-21(27)18-10-12-19(13-11-18)23(26)28/h3-13,20,22H,1-2,14-16H2,(H2,26,28) |
| InChIKey | VQAXDBVWNDLFFI-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 112.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.48 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|