C32H50O2S2Si2 — CID 10603435
tert-butyl-[(1S,5R)-5-[tert-butyl(dimethyl)silyl]oxy-2,3-bis(phenylsulfanylmethyl)cyclohex-2-en-1-yl]oxy-dimethylsilane (PubChem CID 10603435) has the molecular formula C32H50O2S2Si2 and a molecular weight of 587.06 g/mol. Its IUPAC name is tert-butyl-[(1S,5R)-5-[tert-butyl(dimethyl)silyl]oxy-2,3-bis(phenylsulfanylmethyl)cyclohex-2-en-1-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(1S,5R)-5-[tert-butyl(dimethyl)silyl]oxy-2,3-bis(phenylsulfanylmethyl)cyclohex-2-en-1-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 10603435 |
| Molecular Formula | C32H50O2S2Si2 |
| Molecular Weight | 587.06 g/mol |
| Exact Mass | 586.28 |
| IUPAC Name | tert-butyl-[(1S,5R)-5-[tert-butyl(dimethyl)silyl]oxy-2,3-bis(phenylsulfanylmethyl)cyclohex-2-en-1-yl]oxy-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1CC(CSc2ccccc2)=C(CSc2ccccc2)[C@@H](O[Si](C)(C)C(C)(C)C)C1 |
| InChI | InChI=1S/C32H50O2S2Si2/c1-31(2,3)37(7,8)33-26-21-25(23-35-27-17-13-11-14-18-27)29(24-36-28-19-15-12-16-20-28)30(22-26)34-38(9,10)32(4,5)6/h11-20,26,30H,21-24H2,1-10H3/t26-,30+/m1/s1 |
| InChIKey | DWKDWSIJQARBSA-VIZCGCQYSA-N |
| XLogP | 10.44 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.06 |
| LogP ≤ 5 | 10.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|