C30H46Br2N2O2 — CID 10603991
2-(2-bromo-2-methylpropyl)-4-[3-(2-bromo-2-methylpropyl)-5-(diethylaminomethyl)-4-hydroxyphenyl]-6-(diethylaminomethyl)phenol (PubChem CID 10603991) has the molecular formula C30H46Br2N2O2 and a molecular weight of 626.52 g/mol. Its IUPAC name is 2-(2-bromo-2-methylpropyl)-4-[3-(2-bromo-2-methylpropyl)-5-(diethylaminomethyl)-4-hydroxyphenyl]-6-(diethylaminomethyl)phenol.
| Compound Name | 2-(2-bromo-2-methylpropyl)-4-[3-(2-bromo-2-methylpropyl)-5-(diethylaminomethyl)-4-hydroxyphenyl]-6-(diethylaminomethyl)phenol |
|---|---|
| PubChem CID | 10603991 |
| Molecular Formula | C30H46Br2N2O2 |
| Molecular Weight | 626.52 g/mol |
| Exact Mass | 624.19 |
| IUPAC Name | 2-(2-bromo-2-methylpropyl)-4-[3-(2-bromo-2-methylpropyl)-5-(diethylaminomethyl)-4-hydroxyphenyl]-6-(diethylaminomethyl)phenol |
| SMILES | CCN(CC)Cc1cc(-c2cc(CN(CC)CC)c(O)c(CC(C)(C)Br)c2)cc(CC(C)(C)Br)c1O |
| InChI | InChI=1S/C30H46Br2N2O2/c1-9-33(10-2)19-25-15-21(13-23(27(25)35)17-29(5,6)31)22-14-24(18-30(7,8)32)28(36)26(16-22)20-34(11-3)12-4/h13-16,35-36H,9-12,17-20H2,1-8H3 |
| InChIKey | IWHJKSGKXWDPJY-UHFFFAOYSA-N |
| XLogP | 7.88 |
| TPSA | 46.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.52 |
| LogP ≤ 5 | 7.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|