C20H30N2OS3 — CID 139658058
5-[3,5-bis(diethylaminomethyl)-4-hydroxyphenyl]-4-methyldithiole-3-thione (PubChem CID 139658058) has the molecular formula C20H30N2OS3 and a molecular weight of 410.67 g/mol. Its IUPAC name is 5-[3,5-bis(diethylaminomethyl)-4-hydroxyphenyl]-4-methyldithiole-3-thione.
| Compound Name | 5-[3,5-bis(diethylaminomethyl)-4-hydroxyphenyl]-4-methyldithiole-3-thione |
|---|---|
| PubChem CID | 139658058 |
| Molecular Formula | C20H30N2OS3 |
| Molecular Weight | 410.67 g/mol |
| Exact Mass | 410.15 |
| IUPAC Name | 5-[3,5-bis(diethylaminomethyl)-4-hydroxyphenyl]-4-methyldithiole-3-thione |
| SMILES | CCN(CC)Cc1cc(-c2ssc(=S)c2C)cc(CN(CC)CC)c1O |
| InChI | InChI=1S/C20H30N2OS3/c1-6-21(7-2)12-16-10-15(19-14(5)20(24)26-25-19)11-17(18(16)23)13-22(8-3)9-4/h10-11,23H,6-9,12-13H2,1-5H3 |
| InChIKey | CHRIUENVJBQCOR-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.67 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|