C23H36N2O3S3 — CID 139658086
5-[3,5-bis[[ethyl(2-hydroxyethyl)amino]methyl]-4-hydroxyphenyl]-4-butyldithiole-3-thione (PubChem CID 139658086) has the molecular formula C23H36N2O3S3 and a molecular weight of 484.75 g/mol. Its IUPAC name is 5-[3,5-bis[[ethyl(2-hydroxyethyl)amino]methyl]-4-hydroxyphenyl]-4-butyldithiole-3-thione.
| Compound Name | 5-[3,5-bis[[ethyl(2-hydroxyethyl)amino]methyl]-4-hydroxyphenyl]-4-butyldithiole-3-thione |
|---|---|
| PubChem CID | 139658086 |
| Molecular Formula | C23H36N2O3S3 |
| Molecular Weight | 484.75 g/mol |
| Exact Mass | 484.19 |
| IUPAC Name | 5-[3,5-bis[[ethyl(2-hydroxyethyl)amino]methyl]-4-hydroxyphenyl]-4-butyldithiole-3-thione |
| SMILES | CCCCc1c(-c2cc(CN(CC)CCO)c(O)c(CN(CC)CCO)c2)ssc1=S |
| InChI | InChI=1S/C23H36N2O3S3/c1-4-7-8-20-22(30-31-23(20)29)17-13-18(15-24(5-2)9-11-26)21(28)19(14-17)16-25(6-3)10-12-27/h13-14,26-28H,4-12,15-16H2,1-3H3 |
| InChIKey | MPWCQXWSGBSWMT-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 67.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.75 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|