C25H32N2O3S3 — CID 139657839
5-[3,5-bis[[ethyl(2-hydroxyethyl)amino]methyl]-4-hydroxyphenyl]-4-phenyldithiole-3-thione (PubChem CID 139657839) has the molecular formula C25H32N2O3S3 and a molecular weight of 504.74 g/mol. Its IUPAC name is 5-[3,5-bis[[ethyl(2-hydroxyethyl)amino]methyl]-4-hydroxyphenyl]-4-phenyldithiole-3-thione.
| Compound Name | 5-[3,5-bis[[ethyl(2-hydroxyethyl)amino]methyl]-4-hydroxyphenyl]-4-phenyldithiole-3-thione |
|---|---|
| PubChem CID | 139657839 |
| Molecular Formula | C25H32N2O3S3 |
| Molecular Weight | 504.74 g/mol |
| Exact Mass | 504.16 |
| IUPAC Name | 5-[3,5-bis[[ethyl(2-hydroxyethyl)amino]methyl]-4-hydroxyphenyl]-4-phenyldithiole-3-thione |
| SMILES | CCN(CCO)Cc1cc(-c2ssc(=S)c2-c2ccccc2)cc(CN(CC)CCO)c1O |
| InChI | InChI=1S/C25H32N2O3S3/c1-3-26(10-12-28)16-20-14-19(15-21(23(20)30)17-27(4-2)11-13-29)24-22(25(31)33-32-24)18-8-6-5-7-9-18/h5-9,14-15,28-30H,3-4,10-13,16-17H2,1-2H3 |
| InChIKey | XCQGMGUUKOITDM-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 67.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.74 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|