C25H40N2OS3 — CID 139657811
5-[3,5-bis[(dipropylamino)methyl]-4-hydroxyphenyl]-4-ethyldithiole-3-thione (PubChem CID 139657811) has the molecular formula C25H40N2OS3 and a molecular weight of 480.81 g/mol. Its IUPAC name is 5-[3,5-bis[(dipropylamino)methyl]-4-hydroxyphenyl]-4-ethyldithiole-3-thione.
| Compound Name | 5-[3,5-bis[(dipropylamino)methyl]-4-hydroxyphenyl]-4-ethyldithiole-3-thione |
|---|---|
| PubChem CID | 139657811 |
| Molecular Formula | C25H40N2OS3 |
| Molecular Weight | 480.81 g/mol |
| Exact Mass | 480.23 |
| IUPAC Name | 5-[3,5-bis[(dipropylamino)methyl]-4-hydroxyphenyl]-4-ethyldithiole-3-thione |
| SMILES | CCCN(CCC)Cc1cc(-c2ssc(=S)c2CC)cc(CN(CCC)CCC)c1O |
| InChI | InChI=1S/C25H40N2OS3/c1-6-11-26(12-7-2)17-20-15-19(24-22(10-5)25(29)31-30-24)16-21(23(20)28)18-27(13-8-3)14-9-4/h15-16,28H,6-14,17-18H2,1-5H3 |
| InChIKey | VRKYWNZECLVWMJ-UHFFFAOYSA-N |
| XLogP | 7.72 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.81 |
| LogP ≤ 5 | 7.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|