C11H16N6O2S — CID 106051685
1-[4-(methylaminomethyl)phenyl]-N-(2H-tetrazol-5-ylmethyl)methanesulfonamide (PubChem CID 106051685) has the molecular formula C11H16N6O2S and a molecular weight of 296.36 g/mol. Its IUPAC name is 1-[4-(methylaminomethyl)phenyl]-N-(2H-tetrazol-5-ylmethyl)methanesulfonamide.
| Compound Name | 1-[4-(methylaminomethyl)phenyl]-N-(2H-tetrazol-5-ylmethyl)methanesulfonamide |
|---|---|
| PubChem CID | 106051685 |
| Molecular Formula | C11H16N6O2S |
| Molecular Weight | 296.36 g/mol |
| Exact Mass | 296.11 |
| IUPAC Name | 1-[4-(methylaminomethyl)phenyl]-N-(2H-tetrazol-5-ylmethyl)methanesulfonamide |
| SMILES | CNCc1ccc(CS(=O)(=O)NCc2nn[nH]n2)cc1 |
| InChI | InChI=1S/C11H16N6O2S/c1-12-6-9-2-4-10(5-3-9)8-20(18,19)13-7-11-14-16-17-15-11/h2-5,12-13H,6-8H2,1H3,(H,14,15,16,17) |
| InChIKey | NADZRGLUIGOPDT-UHFFFAOYSA-N |
| XLogP | -0.46 |
| TPSA | 112.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.36 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |