C8H13ClN2O2S — CID 106157701
3-[(4-chloro-1,3-thiazol-2-yl)amino]-4-methoxybutan-1-ol (PubChem CID 106157701) has the molecular formula C8H13ClN2O2S and a molecular weight of 236.72 g/mol. Its IUPAC name is 3-[(4-chloro-1,3-thiazol-2-yl)amino]-4-methoxybutan-1-ol.
| Compound Name | 3-[(4-chloro-1,3-thiazol-2-yl)amino]-4-methoxybutan-1-ol |
|---|---|
| PubChem CID | 106157701 |
| Molecular Formula | C8H13ClN2O2S |
| Molecular Weight | 236.72 g/mol |
| Exact Mass | 236.04 |
| IUPAC Name | 3-[(4-chloro-1,3-thiazol-2-yl)amino]-4-methoxybutan-1-ol |
| SMILES | COCC(CCO)Nc1nc(Cl)cs1 |
| InChI | InChI=1S/C8H13ClN2O2S/c1-13-4-6(2-3-12)10-8-11-7(9)5-14-8/h5-6,12H,2-4H2,1H3,(H,10,11) |
| InChIKey | LSBYXINKAWWWSQ-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 54.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.72 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |