C17H26O6 — CID 10616115
[(1R,2R,3S,6S,7S)-6-methyl-5-oxo-7-propan-2-yl-4,8,10-trioxatricyclo[5.2.1.02,6]decan-3-yl]methyl 2,2-dimethylpropanoate (PubChem CID 10616115) has the molecular formula C17H26O6 and a molecular weight of 326.39 g/mol. Its IUPAC name is [(1R,2R,3S,6S,7S)-6-methyl-5-oxo-7-propan-2-yl-4,8,10-trioxatricyclo[5.2.1.02,6]decan-3-yl]methyl 2,2-dimethylpropanoate.
| Compound Name | [(1R,2R,3S,6S,7S)-6-methyl-5-oxo-7-propan-2-yl-4,8,10-trioxatricyclo[5.2.1.02,6]decan-3-yl]methyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 10616115 |
| Molecular Formula | C17H26O6 |
| Molecular Weight | 326.39 g/mol |
| Exact Mass | 326.17 |
| IUPAC Name | [(1R,2R,3S,6S,7S)-6-methyl-5-oxo-7-propan-2-yl-4,8,10-trioxatricyclo[5.2.1.02,6]decan-3-yl]methyl 2,2-dimethylpropanoate |
| SMILES | CC(C)[C@]12OC[C@H](O1)[C@@H]1[C@@H](COC(=O)C(C)(C)C)OC(=O)[C@@]12C |
| InChI | InChI=1S/C17H26O6/c1-9(2)17-16(6)12(11(23-17)8-21-17)10(22-14(16)19)7-20-13(18)15(3,4)5/h9-12H,7-8H2,1-6H3/t10-,11+,12+,16-,17+/m1/s1 |
| InChIKey | TUSWQHREPTWUKV-XJSUSFSXSA-N |
| XLogP | 1.90 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.39 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |