C18H26O6S2 — CID 10811118
[(1S,3aS,4R,6E,6aR)-4-methoxy-3a-methyl-6-(methylsulfanylcarbonylsulfanylmethylidene)-3-oxo-1,4,5,6a-tetrahydrocyclopenta[c]furan-1-yl]methyl 2,2-dimethylpropanoate (PubChem CID 10811118) has the molecular formula C18H26O6S2 and a molecular weight of 402.53 g/mol. Its IUPAC name is [(1S,3aS,4R,6E,6aR)-4-methoxy-3a-methyl-6-(methylsulfanylcarbonylsulfanylmethylidene)-3-oxo-1,4,5,6a-tetrahydrocyclopenta[c]furan-1-yl]methyl 2,2-dimethylpropanoate.
| Compound Name | [(1S,3aS,4R,6E,6aR)-4-methoxy-3a-methyl-6-(methylsulfanylcarbonylsulfanylmethylidene)-3-oxo-1,4,5,6a-tetrahydrocyclopenta[c]furan-1-yl]methyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 10811118 |
| Molecular Formula | C18H26O6S2 |
| Molecular Weight | 402.53 g/mol |
| Exact Mass | 402.12 |
| IUPAC Name | [(1S,3aS,4R,6E,6aR)-4-methoxy-3a-methyl-6-(methylsulfanylcarbonylsulfanylmethylidene)-3-oxo-1,4,5,6a-tetrahydrocyclopenta[c]furan-1-yl]methyl 2,2-dimethylpropanoate |
| SMILES | CO[C@@H]1C/C(=C\SC(=O)SC)[C@@H]2[C@@H](COC(=O)C(C)(C)C)OC(=O)[C@@]21C |
| InChI | InChI=1S/C18H26O6S2/c1-17(2,3)14(19)23-8-11-13-10(9-26-16(21)25-6)7-12(22-5)18(13,4)15(20)24-11/h9,11-13H,7-8H2,1-6H3/b10-9+/t11-,12-,13-,18-/m1/s1 |
| InChIKey | ITMSRGYIKMOGLH-UTCDFKSOSA-N |
| XLogP | 3.64 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.53 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|