C19H29F3O9S — CID 10929065
[(1S,3aS,4R,6R,6aR)-4-methoxy-3a-methyl-3-oxo-4-propan-2-yl-6-(trifluoromethylsulfonyloxymethyl)-6,6a-dihydro-1H-furo[3,4-c]furan-1-yl]methyl 2,2-dimethylpropanoate (PubChem CID 10929065) has the molecular formula C19H29F3O9S and a molecular weight of 490.49 g/mol. Its IUPAC name is [(1S,3aS,4R,6R,6aR)-4-methoxy-3a-methyl-3-oxo-4-propan-2-yl-6-(trifluoromethylsulfonyloxymethyl)-6,6a-dihydro-1H-furo[3,4-c]furan-1-yl]methyl 2,2-dimethylpropanoate.
| Compound Name | [(1S,3aS,4R,6R,6aR)-4-methoxy-3a-methyl-3-oxo-4-propan-2-yl-6-(trifluoromethylsulfonyloxymethyl)-6,6a-dihydro-1H-furo[3,4-c]furan-1-yl]methyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 10929065 |
| Molecular Formula | C19H29F3O9S |
| Molecular Weight | 490.49 g/mol |
| Exact Mass | 490.15 |
| IUPAC Name | [(1S,3aS,4R,6R,6aR)-4-methoxy-3a-methyl-3-oxo-4-propan-2-yl-6-(trifluoromethylsulfonyloxymethyl)-6,6a-dihydro-1H-furo[3,4-c]furan-1-yl]methyl 2,2-dimethylpropanoate |
| SMILES | CO[C@]1(C(C)C)O[C@@H](COS(=O)(=O)C(F)(F)F)[C@@H]2[C@@H](COC(=O)C(C)(C)C)OC(=O)[C@@]21C |
| InChI | InChI=1S/C19H29F3O9S/c1-10(2)18(27-7)17(6)13(12(31-18)9-29-32(25,26)19(20,21)22)11(30-15(17)24)8-28-14(23)16(3,4)5/h10-13H,8-9H2,1-7H3/t11-,12+,13+,17-,18-/m1/s1 |
| InChIKey | JTJGQLGZWYQZMY-RDLJHEDLSA-N |
| XLogP | 2.39 |
| TPSA | 114.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.49 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|