C19H33F3O6S — CID 157192159
2-[(2S,3S,4R,5R)-4-methyl-5-[(2R)-2-methylbutyl]-3-(trifluoromethylsulfonyloxymethyl)oxolan-2-yl]ethyl 2,2-dimethylpropanoate (PubChem CID 157192159) has the molecular formula C19H33F3O6S and a molecular weight of 446.53 g/mol. Its IUPAC name is 2-[(2S,3S,4R,5R)-4-methyl-5-[(2R)-2-methylbutyl]-3-(trifluoromethylsulfonyloxymethyl)oxolan-2-yl]ethyl 2,2-dimethylpropanoate.
| Compound Name | 2-[(2S,3S,4R,5R)-4-methyl-5-[(2R)-2-methylbutyl]-3-(trifluoromethylsulfonyloxymethyl)oxolan-2-yl]ethyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 157192159 |
| Molecular Formula | C19H33F3O6S |
| Molecular Weight | 446.53 g/mol |
| Exact Mass | 446.19 |
| IUPAC Name | 2-[(2S,3S,4R,5R)-4-methyl-5-[(2R)-2-methylbutyl]-3-(trifluoromethylsulfonyloxymethyl)oxolan-2-yl]ethyl 2,2-dimethylpropanoate |
| SMILES | CC[C@@H](C)C[C@H]1O[C@@H](CCOC(=O)C(C)(C)C)[C@H](COS(=O)(=O)C(F)(F)F)[C@H]1C |
| InChI | InChI=1S/C19H33F3O6S/c1-7-12(2)10-16-13(3)14(11-27-29(24,25)19(20,21)22)15(28-16)8-9-26-17(23)18(4,5)6/h12-16H,7-11H2,1-6H3/t12-,13-,14-,15+,16-/m1/s1 |
| InChIKey | JMXVKQAKCPOFNV-DGXTUMSLSA-N |
| XLogP | 4.29 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.53 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|