C17H34O4Si — CID 10616454
[(6S,7R)-6-methyl-7-(2-trimethylsilylethoxymethoxy)oct-1-en-4-yl] acetate (PubChem CID 10616454) has the molecular formula C17H34O4Si and a molecular weight of 330.54 g/mol. Its IUPAC name is [(6S,7R)-6-methyl-7-(2-trimethylsilylethoxymethoxy)oct-1-en-4-yl] acetate.
| Compound Name | [(6S,7R)-6-methyl-7-(2-trimethylsilylethoxymethoxy)oct-1-en-4-yl] acetate |
|---|---|
| PubChem CID | 10616454 |
| Molecular Formula | C17H34O4Si |
| Molecular Weight | 330.54 g/mol |
| Exact Mass | 330.22 |
| IUPAC Name | [(6S,7R)-6-methyl-7-(2-trimethylsilylethoxymethoxy)oct-1-en-4-yl] acetate |
| SMILES | C=CCC(C[C@H](C)[C@@H](C)OCOCC[Si](C)(C)C)OC(C)=O |
| InChI | InChI=1S/C17H34O4Si/c1-8-9-17(21-16(4)18)12-14(2)15(3)20-13-19-10-11-22(5,6)7/h8,14-15,17H,1,9-13H2,2-7H3/t14-,15+,17?/m0/s1 |
| InChIKey | DROMGDNIQWZSFI-BTPDTDQASA-N |
| XLogP | 4.24 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.54 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|