C30H66O3Si3 — CID 10626653
trimethyl-[(1R,2R,4R,5R,6R,8R,9R)-2,4,6,8,10-pentamethyl-1-[(E,2R)-pent-3-en-2-yl]-5,9-bis(trimethylsilyloxy)undecoxy]silane (PubChem CID 10626653) has the molecular formula C30H66O3Si3 and a molecular weight of 559.11 g/mol. Its IUPAC name is trimethyl-[(1R,2R,4R,5R,6R,8R,9R)-2,4,6,8,10-pentamethyl-1-[(E,2R)-pent-3-en-2-yl]-5,9-bis(trimethylsilyloxy)undecoxy]silane.
| Compound Name | trimethyl-[(1R,2R,4R,5R,6R,8R,9R)-2,4,6,8,10-pentamethyl-1-[(E,2R)-pent-3-en-2-yl]-5,9-bis(trimethylsilyloxy)undecoxy]silane |
|---|---|
| PubChem CID | 10626653 |
| Molecular Formula | C30H66O3Si3 |
| Molecular Weight | 559.11 g/mol |
| Exact Mass | 558.43 |
| IUPAC Name | trimethyl-[(1R,2R,4R,5R,6R,8R,9R)-2,4,6,8,10-pentamethyl-1-[(E,2R)-pent-3-en-2-yl]-5,9-bis(trimethylsilyloxy)undecoxy]silane |
| SMILES | C/C=C/[C@@H](C)[C@H](O[Si](C)(C)C)[C@H](C)C[C@@H](C)[C@H](O[Si](C)(C)C)[C@H](C)C[C@@H](C)[C@H](O[Si](C)(C)C)C(C)C |
| InChI | InChI=1S/C30H66O3Si3/c1-18-19-23(4)29(32-35(12,13)14)25(6)21-27(8)30(33-36(15,16)17)26(7)20-24(5)28(22(2)3)31-34(9,10)11/h18-19,22-30H,20-21H2,1-17H3/b19-18+/t23-,24-,25-,26-,27-,28-,29+,30-/m1/s1 |
| InChIKey | RPHAGIJLZXIHFQ-GXFQZFLGSA-N |
| XLogP | 9.84 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.11 |
| LogP ≤ 5 | 9.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|