C41H44BN — CID 10626711
2-[(1S)-1-cyclohexylethyl]-3,4-dihydroisoquinolin-2-ium;tetraphenylboranuide (PubChem CID 10626711) has the molecular formula C41H44BN and a molecular weight of 561.62 g/mol. Its IUPAC name is 2-[(1S)-1-cyclohexylethyl]-3,4-dihydroisoquinolin-2-ium;tetraphenylboranuide.
| Compound Name | 2-[(1S)-1-cyclohexylethyl]-3,4-dihydroisoquinolin-2-ium;tetraphenylboranuide |
|---|---|
| PubChem CID | 10626711 |
| Molecular Formula | C41H44BN |
| Molecular Weight | 561.62 g/mol |
| Exact Mass | 561.36 |
| IUPAC Name | 2-[(1S)-1-cyclohexylethyl]-3,4-dihydroisoquinolin-2-ium;tetraphenylboranuide |
| SMILES | C[C@@H](C1CCCCC1)[N+]1=Cc2ccccc2CC1.c1ccc([B-](c2ccccc2)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C24H20B.C17H24N/c1-5-13-21(14-6-1)25(22-15-7-2-8-16-22,23-17-9-3-10-18-23)24-19-11-4-12-20-24;1-14(15-7-3-2-4-8-15)18-12-11-16-9-5-6-10-17(16)13-18/h1-20H;5-6,9-10,13-15H,2-4,7-8,11-12H2,1H3/q-1;+1/t;14-/m.0/s1 |
| InChIKey | GDPXMHMBJIVGEC-SYHXRIJYSA-N |
| XLogP | 6.71 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.62 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|