C18H18NO+ — CID 11828023
(1R,2S)-1-(3,4-dihydroisoquinolin-2-ium-2-yl)-2,3-dihydro-1H-inden-2-ol (PubChem CID 11828023) has the molecular formula C18H18NO+ and a molecular weight of 264.35 g/mol. Its IUPAC name is (1R,2S)-1-(3,4-dihydroisoquinolin-2-ium-2-yl)-2,3-dihydro-1H-inden-2-ol.
| Compound Name | (1R,2S)-1-(3,4-dihydroisoquinolin-2-ium-2-yl)-2,3-dihydro-1H-inden-2-ol |
|---|---|
| PubChem CID | 11828023 |
| Molecular Formula | C18H18NO+ |
| Molecular Weight | 264.35 g/mol |
| Exact Mass | 264.14 |
| IUPAC Name | (1R,2S)-1-(3,4-dihydroisoquinolin-2-ium-2-yl)-2,3-dihydro-1H-inden-2-ol |
| SMILES | O[C@H]1Cc2ccccc2[C@H]1[N+]1=Cc2ccccc2CC1 |
| InChI | InChI=1S/C18H18NO/c20-17-11-14-6-3-4-8-16(14)18(17)19-10-9-13-5-1-2-7-15(13)12-19/h1-8,12,17-18,20H,9-11H2/q+1/t17-,18+/m0/s1 |
| InChIKey | BPRIHESGTSGHDU-ZWKOTPCHSA-N |
| XLogP | 2.33 |
| TPSA | 23.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.35 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|