C18H20NO+ — CID 101143691
(1S,2R)-2-(3,4-dihydroisoquinolin-2-ium-2-yl)-1-phenylpropan-1-ol (PubChem CID 101143691) has the molecular formula C18H20NO+ and a molecular weight of 266.36 g/mol. Its IUPAC name is (1S,2R)-2-(3,4-dihydroisoquinolin-2-ium-2-yl)-1-phenylpropan-1-ol.
| Compound Name | (1S,2R)-2-(3,4-dihydroisoquinolin-2-ium-2-yl)-1-phenylpropan-1-ol |
|---|---|
| PubChem CID | 101143691 |
| Molecular Formula | C18H20NO+ |
| Molecular Weight | 266.36 g/mol |
| Exact Mass | 266.15 |
| IUPAC Name | (1S,2R)-2-(3,4-dihydroisoquinolin-2-ium-2-yl)-1-phenylpropan-1-ol |
| SMILES | C[C@H]([C@@H](O)c1ccccc1)[N+]1=Cc2ccccc2CC1 |
| InChI | InChI=1S/C18H20NO/c1-14(18(20)16-8-3-2-4-9-16)19-12-11-15-7-5-6-10-17(15)13-19/h2-10,13-14,18,20H,11-12H2,1H3/q+1/t14-,18-/m1/s1 |
| InChIKey | OMEMSKPNUKGNIX-RDTXWAMCSA-N |
| XLogP | 2.80 |
| TPSA | 23.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.36 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|