C24H26NO+ — CID 2775300
2-(6-methyl-5,7-dihydrobenzo[d][2]benzazepin-6-ium-6-yl)-1-phenylpropan-1-ol (PubChem CID 2775300) has the molecular formula C24H26NO+ and a molecular weight of 344.48 g/mol. Its IUPAC name is 2-(6-methyl-5,7-dihydrobenzo[d][2]benzazepin-6-ium-6-yl)-1-phenylpropan-1-ol.
| Compound Name | 2-(6-methyl-5,7-dihydrobenzo[d][2]benzazepin-6-ium-6-yl)-1-phenylpropan-1-ol |
|---|---|
| PubChem CID | 2775300 |
| Molecular Formula | C24H26NO+ |
| Molecular Weight | 344.48 g/mol |
| Exact Mass | 344.20 |
| IUPAC Name | 2-(6-methyl-5,7-dihydrobenzo[d][2]benzazepin-6-ium-6-yl)-1-phenylpropan-1-ol |
| SMILES | CC(C(O)c1ccccc1)[N+]1(C)Cc2ccccc2-c2ccccc2C1 |
| InChI | InChI=1S/C24H26NO/c1-18(24(26)19-10-4-3-5-11-19)25(2)16-20-12-6-8-14-22(20)23-15-9-7-13-21(23)17-25/h3-15,18,24,26H,16-17H2,1-2H3/q+1 |
| InChIKey | TXHDLAJCZMAFEG-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.48 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|