About (1R,2S)-2-(6-methyl-5,7-dihydrobenzo[d][2]benzazepin-6-ium-6-yl)-1-phenylpropan-1-ol
(1R,2S)-2-(6-methyl-5,7-dihydrobenzo[d][2]benzazepin-6-ium-6-yl)-1-phenylpropan-1-ol (PubChem CID 7004662) has the molecular formula C24H26NO+
and a molecular weight of 344.48 g/mol. Its IUPAC name is (1R,2S)-2-(6-methyl-5,7-dihydrobenzo[d][2]benzazepin-6-ium-6-yl)-1-phenylpropan-1-ol.
Molecular Properties
| Compound Name | (1R,2S)-2-(6-methyl-5,7-dihydrobenzo[d][2]benzazepin-6-ium-6-yl)-1-phenylpropan-1-ol |
| PubChem CID | 7004662 |
| Molecular Formula | C24H26NO+ |
| Molecular Weight | 344.48 g/mol |
| Exact Mass | 344.20 |
| IUPAC Name | (1R,2S)-2-(6-methyl-5,7-dihydrobenzo[d][2]benzazepin-6-ium-6-yl)-1-phenylpropan-1-ol |
| SMILES | C[C@@H]([C@H](O)c1ccccc1)[N+]1(C)Cc2ccccc2-c2ccccc2C1 |
| InChI | InChI=1S/C24H26NO/c1-18(24(26)19-10-4-3-5-11-19)25(2)16-20-12-6-8-14-22(20)23-15-9-7-13-21(23)17-25/h3-15,18,24,26H,16-17H2,1-2H3/q+1/t18-,24-/m0/s1 |
| InChIKey | TXHDLAJCZMAFEG-UUOWRZLLSA-N |
| XLogP | 4.94 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.48 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze (1R,2S)-2-(6-methyl-5,7-dihydrobenzo[d][2]benzazepin-6-ium-6-yl)-1-phenylpropan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R,2S)-2-(6-methyl-5,7-dihydrobenzo[d][2]benzazepin-6-ium-6-yl)-1-phenylpropan-1-ol?
The IUPAC name of (1R,2S)-2-(6-methyl-5,7-dihydrobenzo[d][2]benzazepin-6-ium-6-yl)-1-phenylpropan-1-ol (CID 7004662) is (1R,2S)-2-(6-methyl-5,7-dihydrobenzo[d][2]benzazepin-6-ium-6-yl)-1-phenylpropan-1-ol.
What is the SMILES notation for (1R,2S)-2-(6-methyl-5,7-dihydrobenzo[d][2]benzazepin-6-ium-6-yl)-1-phenylpropan-1-ol?
The canonical SMILES for (1R,2S)-2-(6-methyl-5,7-dihydrobenzo[d][2]benzazepin-6-ium-6-yl)-1-phenylpropan-1-ol is C[C@@H]([C@H](O)c1ccccc1)[N+]1(C)Cc2ccccc2-c2ccccc2C1.
What is the InChIKey of (1R,2S)-2-(6-methyl-5,7-dihydrobenzo[d][2]benzazepin-6-ium-6-yl)-1-phenylpropan-1-ol?
The InChIKey is TXHDLAJCZMAFEG-UUOWRZLLSA-N. The full InChI is InChI=1S/C24H26NO/c1-18(24(26)19-10-4-3-5-11-19)25(2)16-20-12-6-8-14-22(20)23-15-9-7-13-21(23)17-25/h3-15,18,24,26H,16-17H2,1-2H3/q+1/t18-,24-/m0/s1.
What are the key properties of (1R,2S)-2-(6-methyl-5,7-dihydrobenzo[d][2]benzazepin-6-ium-6-yl)-1-phenylpropan-1-ol?
(1R,2S)-2-(6-methyl-5,7-dihydrobenzo[d][2]benzazepin-6-ium-6-yl)-1-phenylpropan-1-ol has a molecular weight of 344.48 g/mol, XLogP of 4.94, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (1R,2S)-2-(6-methyl-5,7-dihydrobenzo[d][2]benzazepin-6-ium-6-yl)-1-phenylpropan-1-ol is sourced from PubChem (CID 7004662), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).