C10H6Br3N — CID 10643715
5,6,7,8-tetradeuterio-2-(tribromomethyl)quinoline (PubChem CID 10643715) has the molecular formula C10H6Br3N and a molecular weight of 383.90 g/mol. Its IUPAC name is 5,6,7,8-tetradeuterio-2-(tribromomethyl)quinoline.
| Compound Name | 5,6,7,8-tetradeuterio-2-(tribromomethyl)quinoline |
|---|---|
| PubChem CID | 10643715 |
| Molecular Formula | C10H6Br3N |
| Molecular Weight | 383.90 g/mol |
| Exact Mass | 380.83 |
| IUPAC Name | 5,6,7,8-tetradeuterio-2-(tribromomethyl)quinoline |
| SMILES | [2H]c1c([2H])c([2H])c2nc(C(Br)(Br)Br)ccc2c1[2H] |
| InChI | InChI=1S/C10H6Br3N/c11-10(12,13)9-6-5-7-3-1-2-4-8(7)14-9/h1-6H/i1D,2D,3D,4D |
| InChIKey | UDYYQHILRSDDMP-RHQRLBAQSA-N |
| XLogP | 4.53 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.90 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|