C39H40N2O5SSi — CID 10652116
3-benzoyl-1-[(3S,4S,5R)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-phenylmethoxythiolan-3-yl]pyrimidine-2,4-dione (PubChem CID 10652116) has the molecular formula C39H40N2O5SSi and a molecular weight of 676.91 g/mol. Its IUPAC name is 3-benzoyl-1-[(3S,4S,5R)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-phenylmethoxythiolan-3-yl]pyrimidine-2,4-dione.
| Compound Name | 3-benzoyl-1-[(3S,4S,5R)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-phenylmethoxythiolan-3-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 10652116 |
| Molecular Formula | C39H40N2O5SSi |
| Molecular Weight | 676.91 g/mol |
| Exact Mass | 676.24 |
| IUPAC Name | 3-benzoyl-1-[(3S,4S,5R)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-phenylmethoxythiolan-3-yl]pyrimidine-2,4-dione |
| SMILES | CC(C)(C)[Si](OC[C@H]1SC[C@@H](n2ccc(=O)n(C(=O)c3ccccc3)c2=O)[C@@H]1OCc1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C39H40N2O5SSi/c1-39(2,3)48(31-20-12-6-13-21-31,32-22-14-7-15-23-32)46-27-34-36(45-26-29-16-8-4-9-17-29)33(28-47-34)40-25-24-35(42)41(38(40)44)37(43)30-18-10-5-11-19-30/h4-25,33-34,36H,26-28H2,1-3H3/t33-,34-,36+/m1/s1 |
| InChIKey | HWMIYTOHEYSJGS-KXFQFMHUSA-N |
| XLogP | 5.52 |
| TPSA | 79.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.91 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|