C11H9NO3S — CID 10657395
3,3-dioxo-4,5-dihydrobenzo[e][1,2]benzothiazol-1-one (PubChem CID 10657395) has the molecular formula C11H9NO3S and a molecular weight of 235.26 g/mol. Its IUPAC name is 3,3-dioxo-4,5-dihydrobenzo[e][1,2]benzothiazol-1-one.
| Compound Name | 3,3-dioxo-4,5-dihydrobenzo[e][1,2]benzothiazol-1-one |
|---|---|
| PubChem CID | 10657395 |
| Molecular Formula | C11H9NO3S |
| Molecular Weight | 235.26 g/mol |
| Exact Mass | 235.03 |
| IUPAC Name | 3,3-dioxo-4,5-dihydrobenzo[e][1,2]benzothiazol-1-one |
| SMILES | O=C1NS(=O)(=O)C2=C1c1ccccc1CC2 |
| InChI | InChI=1S/C11H9NO3S/c13-11-10-8-4-2-1-3-7(8)5-6-9(10)16(14,15)12-11/h1-4H,5-6H2,(H,12,13) |
| InChIKey | FQQKRUKJXLLRPE-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.26 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |