C13H15NO5 — CID 10659330
[(3R,3aS,5R,6aS)-5-methyl-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-3-yl] pyridin-2-yl carbonate (PubChem CID 10659330) has the molecular formula C13H15NO5 and a molecular weight of 265.26 g/mol. Its IUPAC name is [(3R,3aS,5R,6aS)-5-methyl-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-3-yl] pyridin-2-yl carbonate.
| Compound Name | [(3R,3aS,5R,6aS)-5-methyl-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-3-yl] pyridin-2-yl carbonate |
|---|---|
| PubChem CID | 10659330 |
| Molecular Formula | C13H15NO5 |
| Molecular Weight | 265.26 g/mol |
| Exact Mass | 265.10 |
| IUPAC Name | [(3R,3aS,5R,6aS)-5-methyl-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-3-yl] pyridin-2-yl carbonate |
| SMILES | C[C@@H]1C[C@@H]2[C@@H](OC[C@@H]2OC(=O)Oc2ccccn2)O1 |
| InChI | InChI=1S/C13H15NO5/c1-8-6-9-10(7-16-12(9)17-8)18-13(15)19-11-4-2-3-5-14-11/h2-5,8-10,12H,6-7H2,1H3/t8-,9+,10+,12+/m1/s1 |
| InChIKey | NTWPZHNDMSUILT-WDCWCFNPSA-N |
| XLogP | 1.75 |
| TPSA | 66.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.26 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |