C10H12BrClN2O3S — CID 106606150
4-(3-bromo-4-chlorophenyl)sulfonylmorpholin-3-amine (PubChem CID 106606150) has the molecular formula C10H12BrClN2O3S and a molecular weight of 355.64 g/mol. Its IUPAC name is 4-(3-bromo-4-chlorophenyl)sulfonylmorpholin-3-amine.
| Compound Name | 4-(3-bromo-4-chlorophenyl)sulfonylmorpholin-3-amine |
|---|---|
| PubChem CID | 106606150 |
| Molecular Formula | C10H12BrClN2O3S |
| Molecular Weight | 355.64 g/mol |
| Exact Mass | 353.94 |
| IUPAC Name | 4-(3-bromo-4-chlorophenyl)sulfonylmorpholin-3-amine |
| SMILES | NC1COCCN1S(=O)(=O)c1ccc(Cl)c(Br)c1 |
| InChI | InChI=1S/C10H12BrClN2O3S/c11-8-5-7(1-2-9(8)12)18(15,16)14-3-4-17-6-10(14)13/h1-2,5,10H,3-4,6,13H2 |
| InChIKey | RSALFKBJMLAOCQ-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.64 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |