C22H30N4 — CID 10665582
N-butyl-2,5,6-trimethyl-7-(2,4,6-trimethylphenyl)pyrrolo[2,3-d]pyrimidin-4-amine (PubChem CID 10665582) has the molecular formula C22H30N4 and a molecular weight of 350.51 g/mol. Its IUPAC name is N-butyl-2,5,6-trimethyl-7-(2,4,6-trimethylphenyl)pyrrolo[2,3-d]pyrimidin-4-amine.
| Compound Name | N-butyl-2,5,6-trimethyl-7-(2,4,6-trimethylphenyl)pyrrolo[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 10665582 |
| Molecular Formula | C22H30N4 |
| Molecular Weight | 350.51 g/mol |
| Exact Mass | 350.25 |
| IUPAC Name | N-butyl-2,5,6-trimethyl-7-(2,4,6-trimethylphenyl)pyrrolo[2,3-d]pyrimidin-4-amine |
| SMILES | CCCCNc1nc(C)nc2c1c(C)c(C)n2-c1c(C)cc(C)cc1C |
| InChI | InChI=1S/C22H30N4/c1-8-9-10-23-21-19-16(5)17(6)26(22(19)25-18(7)24-21)20-14(3)11-13(2)12-15(20)4/h11-12H,8-10H2,1-7H3,(H,23,24,25) |
| InChIKey | YSRDKCMEEQUANM-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.51 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|