C21H25N3O2 — CID 10665637
1-(benzotriazol-1-yl)-5-(2,5-dimethylphenoxy)-2,2-dimethylpentan-1-one (PubChem CID 10665637) has the molecular formula C21H25N3O2 and a molecular weight of 351.45 g/mol. Its IUPAC name is 1-(benzotriazol-1-yl)-5-(2,5-dimethylphenoxy)-2,2-dimethylpentan-1-one.
| Compound Name | 1-(benzotriazol-1-yl)-5-(2,5-dimethylphenoxy)-2,2-dimethylpentan-1-one |
|---|---|
| PubChem CID | 10665637 |
| Molecular Formula | C21H25N3O2 |
| Molecular Weight | 351.45 g/mol |
| Exact Mass | 351.19 |
| IUPAC Name | 1-(benzotriazol-1-yl)-5-(2,5-dimethylphenoxy)-2,2-dimethylpentan-1-one |
| SMILES | Cc1ccc(C)c(OCCCC(C)(C)C(=O)n2nnc3ccccc32)c1 |
| InChI | InChI=1S/C21H25N3O2/c1-15-10-11-16(2)19(14-15)26-13-7-12-21(3,4)20(25)24-18-9-6-5-8-17(18)22-23-24/h5-6,8-11,14H,7,12-13H2,1-4H3 |
| InChIKey | IPMFAVVHTWJJFW-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.45 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|