C9H15ClN2O — CID 106684695
N-[(2-chlorofuran-3-yl)methyl]-N',N'-dimethylethane-1,2-diamine (PubChem CID 106684695) has the molecular formula C9H15ClN2O and a molecular weight of 202.69 g/mol. Its IUPAC name is N-[(2-chlorofuran-3-yl)methyl]-N',N'-dimethylethane-1,2-diamine.
| Compound Name | N-[(2-chlorofuran-3-yl)methyl]-N',N'-dimethylethane-1,2-diamine |
|---|---|
| PubChem CID | 106684695 |
| Molecular Formula | C9H15ClN2O |
| Molecular Weight | 202.69 g/mol |
| Exact Mass | 202.09 |
| IUPAC Name | N-[(2-chlorofuran-3-yl)methyl]-N',N'-dimethylethane-1,2-diamine |
| SMILES | CN(C)CCNCc1ccoc1Cl |
| InChI | InChI=1S/C9H15ClN2O/c1-12(2)5-4-11-7-8-3-6-13-9(8)10/h3,6,11H,4-5,7H2,1-2H3 |
| InChIKey | KJCMMHCRBQQTEG-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 28.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.69 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|