C24H47NO2Sn — CID 10672999
(E,4R,5R)-5-hydroxy-4,6-dimethyl-N-[(E)-3-tributylstannylprop-2-enyl]hept-2-enamide (PubChem CID 10672999) has the molecular formula C24H47NO2Sn and a molecular weight of 500.36 g/mol. Its IUPAC name is (E,4R,5R)-5-hydroxy-4,6-dimethyl-N-[(E)-3-tributylstannylprop-2-enyl]hept-2-enamide.
| Compound Name | (E,4R,5R)-5-hydroxy-4,6-dimethyl-N-[(E)-3-tributylstannylprop-2-enyl]hept-2-enamide |
|---|---|
| PubChem CID | 10672999 |
| Molecular Formula | C24H47NO2Sn |
| Molecular Weight | 500.36 g/mol |
| Exact Mass | 501.26 |
| IUPAC Name | (E,4R,5R)-5-hydroxy-4,6-dimethyl-N-[(E)-3-tributylstannylprop-2-enyl]hept-2-enamide |
| SMILES | CCCC[Sn](/C=C/CNC(=O)/C=C/[C@@H](C)[C@H](O)C(C)C)(CCCC)CCCC |
| InChI | InChI=1S/C12H20NO2.3C4H9.Sn/c1-5-8-13-11(14)7-6-10(4)12(15)9(2)3;3*1-3-4-2;/h1,5-7,9-10,12,15H,8H2,2-4H3,(H,13,14);3*1,3-4H2,2H3;/b5-1?,7-6+;;;;/t10-,12-;;;;/m1..../s1 |
| InChIKey | SAPQLUDBUWSAGV-FEQNSOPJSA-N |
| XLogP | 6.26 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.36 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|