C21H29NO2 — CID 91500393
10-hydroxy-11,19-dimethyl-1-azacycloicosa-3,5,7,13,15,17-hexaen-2-one (PubChem CID 91500393) has the molecular formula C21H29NO2 and a molecular weight of 327.47 g/mol. Its IUPAC name is 10-hydroxy-11,19-dimethyl-1-azacycloicosa-3,5,7,13,15,17-hexaen-2-one.
| Compound Name | 10-hydroxy-11,19-dimethyl-1-azacycloicosa-3,5,7,13,15,17-hexaen-2-one |
|---|---|
| PubChem CID | 91500393 |
| Molecular Formula | C21H29NO2 |
| Molecular Weight | 327.47 g/mol |
| Exact Mass | 327.22 |
| IUPAC Name | 10-hydroxy-11,19-dimethyl-1-azacycloicosa-3,5,7,13,15,17-hexaen-2-one |
| SMILES | CC1C=CC=CC=CCC(C)C(O)CC=CC=CC=CC(=O)NC1 |
| InChI | InChI=1S/C21H29NO2/c1-18-13-9-5-3-6-10-14-19(2)20(23)15-11-7-4-8-12-16-21(24)22-17-18/h3-13,16,18-20,23H,14-15,17H2,1-2H3,(H,22,24) |
| InChIKey | JXNRPSLEDMAULL-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.47 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |