C24H37ClF2N6O3S — CID 10674456
2-[(4S)-4-[(6-chloro-3,3-dimethyl-2,4-dihydro-1H-quinolin-8-yl)sulfonylamino]-5-[4-(2,2-difluoroethyl)piperidin-1-yl]-5-oxopentyl]guanidine (PubChem CID 10674456) has the molecular formula C24H37ClF2N6O3S and a molecular weight of 563.12 g/mol. Its IUPAC name is 2-[(4S)-4-[(6-chloro-3,3-dimethyl-2,4-dihydro-1H-quinolin-8-yl)sulfonylamino]-5-[4-(2,2-difluoroethyl)piperidin-1-yl]-5-oxopentyl]guanidine.
| Compound Name | 2-[(4S)-4-[(6-chloro-3,3-dimethyl-2,4-dihydro-1H-quinolin-8-yl)sulfonylamino]-5-[4-(2,2-difluoroethyl)piperidin-1-yl]-5-oxopentyl]guanidine |
|---|---|
| PubChem CID | 10674456 |
| Molecular Formula | C24H37ClF2N6O3S |
| Molecular Weight | 563.12 g/mol |
| Exact Mass | 562.23 |
| IUPAC Name | 2-[(4S)-4-[(6-chloro-3,3-dimethyl-2,4-dihydro-1H-quinolin-8-yl)sulfonylamino]-5-[4-(2,2-difluoroethyl)piperidin-1-yl]-5-oxopentyl]guanidine |
| SMILES | CC1(C)CNc2c(cc(Cl)cc2S(=O)(=O)N[C@@H](CCCN=C(N)N)C(=O)N2CCC(CC(F)F)CC2)C1 |
| InChI | InChI=1S/C24H37ClF2N6O3S/c1-24(2)13-16-11-17(25)12-19(21(16)31-14-24)37(35,36)32-18(4-3-7-30-23(28)29)22(34)33-8-5-15(6-9-33)10-20(26)27/h11-12,15,18,20,31-32H,3-10,13-14H2,1-2H3,(H4,28,29,30)/t18-/m0/s1 |
| InChIKey | AAFRZDWLMMZHGP-SFHVURJKSA-N |
| XLogP | 2.93 |
| TPSA | 142.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.12 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|