C32H29ClF3O3P — CID 10674828
3-chloro-1,1,1-trifluoro-4-[(2-methylpropan-2-yl)oxy]-4-oxo-2-phenyl-3-triphenylphosphaniumylbutan-2-olate (PubChem CID 10674828) has the molecular formula C32H29ClF3O3P and a molecular weight of 585.00 g/mol. Its IUPAC name is 3-chloro-1,1,1-trifluoro-4-[(2-methylpropan-2-yl)oxy]-4-oxo-2-phenyl-3-triphenylphosphaniumylbutan-2-olate.
| Compound Name | 3-chloro-1,1,1-trifluoro-4-[(2-methylpropan-2-yl)oxy]-4-oxo-2-phenyl-3-triphenylphosphaniumylbutan-2-olate |
|---|---|
| PubChem CID | 10674828 |
| Molecular Formula | C32H29ClF3O3P |
| Molecular Weight | 585.00 g/mol |
| Exact Mass | 584.15 |
| IUPAC Name | 3-chloro-1,1,1-trifluoro-4-[(2-methylpropan-2-yl)oxy]-4-oxo-2-phenyl-3-triphenylphosphaniumylbutan-2-olate |
| SMILES | CC(C)(C)OC(=O)C(Cl)(C([O-])(c1ccccc1)C(F)(F)F)[P+](c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C32H29ClF3O3P/c1-29(2,3)39-28(37)31(33,30(38,32(34,35)36)24-16-8-4-9-17-24)40(25-18-10-5-11-19-25,26-20-12-6-13-21-26)27-22-14-7-15-23-27/h4-23H,1-3H3 |
| InChIKey | GQPNPKILSYVJJY-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 49.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.00 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|