C19H34O3 — CID 10686429
(E)-1-(1,4-dioxaspiro[4.5]decan-7-yl)undec-1-en-3-ol (PubChem CID 10686429) has the molecular formula C19H34O3 and a molecular weight of 310.48 g/mol. Its IUPAC name is (E)-1-(1,4-dioxaspiro[4.5]decan-7-yl)undec-1-en-3-ol.
| Compound Name | (E)-1-(1,4-dioxaspiro[4.5]decan-7-yl)undec-1-en-3-ol |
|---|---|
| PubChem CID | 10686429 |
| Molecular Formula | C19H34O3 |
| Molecular Weight | 310.48 g/mol |
| Exact Mass | 310.25 |
| IUPAC Name | (E)-1-(1,4-dioxaspiro[4.5]decan-7-yl)undec-1-en-3-ol |
| SMILES | CCCCCCCCC(O)/C=C/C1CCCC2(C1)OCCO2 |
| InChI | InChI=1S/C19H34O3/c1-2-3-4-5-6-7-10-18(20)12-11-17-9-8-13-19(16-17)21-14-15-22-19/h11-12,17-18,20H,2-10,13-16H2,1H3/b12-11+ |
| InChIKey | CUWBVKOPYKTBPU-VAWYXSNFSA-N |
| XLogP | 4.59 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.48 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|