C23H23N3O7S — CID 10696262
(4-nitrophenyl)methyl (4Z,8R)-7-(4-methylphenyl)sulfonyl-10-oxo-1,7-diazabicyclo[6.2.0]dec-4-ene-2-carboxylate (PubChem CID 10696262) has the molecular formula C23H23N3O7S and a molecular weight of 485.52 g/mol. Its IUPAC name is (4-nitrophenyl)methyl (4Z,8R)-7-(4-methylphenyl)sulfonyl-10-oxo-1,7-diazabicyclo[6.2.0]dec-4-ene-2-carboxylate.
| Compound Name | (4-nitrophenyl)methyl (4Z,8R)-7-(4-methylphenyl)sulfonyl-10-oxo-1,7-diazabicyclo[6.2.0]dec-4-ene-2-carboxylate |
|---|---|
| PubChem CID | 10696262 |
| Molecular Formula | C23H23N3O7S |
| Molecular Weight | 485.52 g/mol |
| Exact Mass | 485.13 |
| IUPAC Name | (4-nitrophenyl)methyl (4Z,8R)-7-(4-methylphenyl)sulfonyl-10-oxo-1,7-diazabicyclo[6.2.0]dec-4-ene-2-carboxylate |
| SMILES | Cc1ccc(S(=O)(=O)N2C/C=C\CC(C(=O)OCc3ccc([N+](=O)[O-])cc3)N3C(=O)C[C@H]32)cc1 |
| InChI | InChI=1S/C23H23N3O7S/c1-16-5-11-19(12-6-16)34(31,32)24-13-3-2-4-20(25-21(24)14-22(25)27)23(28)33-15-17-7-9-18(10-8-17)26(29)30/h2-3,5-12,20-21H,4,13-15H2,1H3/b3-2-/t20?,21-/m0/s1 |
| InChIKey | YXGUHCALHFXMGQ-HUAWUWFQSA-N |
| XLogP | 2.52 |
| TPSA | 127.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.52 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|