C30H34ClN3O4 — CID 10697617
(2S,3R)-2-[(1S,2R,3R)-4-azido-1,2,3-tris(phenylmethoxy)butyl]-3-(3-chloropropyl)oxirane (PubChem CID 10697617) has the molecular formula C30H34ClN3O4 and a molecular weight of 536.07 g/mol. Its IUPAC name is (2S,3R)-2-[(1S,2R,3R)-4-azido-1,2,3-tris(phenylmethoxy)butyl]-3-(3-chloropropyl)oxirane.
| Compound Name | (2S,3R)-2-[(1S,2R,3R)-4-azido-1,2,3-tris(phenylmethoxy)butyl]-3-(3-chloropropyl)oxirane |
|---|---|
| PubChem CID | 10697617 |
| Molecular Formula | C30H34ClN3O4 |
| Molecular Weight | 536.07 g/mol |
| Exact Mass | 535.22 |
| IUPAC Name | (2S,3R)-2-[(1S,2R,3R)-4-azido-1,2,3-tris(phenylmethoxy)butyl]-3-(3-chloropropyl)oxirane |
| SMILES | [N-]=[N+]=NC[C@@H](OCc1ccccc1)[C@@H](OCc1ccccc1)[C@H](OCc1ccccc1)[C@H]1O[C@@H]1CCCCl |
| InChI | InChI=1S/C30H34ClN3O4/c31-18-10-17-26-29(38-26)30(37-22-25-15-8-3-9-16-25)28(36-21-24-13-6-2-7-14-24)27(19-33-34-32)35-20-23-11-4-1-5-12-23/h1-9,11-16,26-30H,10,17-22H2/t26-,27-,28-,29+,30+/m1/s1 |
| InChIKey | ZZBBZVGXJFEHEP-LBEKWILNSA-N |
| XLogP | 6.84 |
| TPSA | 88.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.07 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|