C28H29F3O8 — CID 10697908
[(1R,2S,7S,8R,9S,17S)-7-hydroxy-1,17-dimethyl-12-methylidene-14,16-dioxo-10,13-dioxatetracyclo[7.7.1.02,7.011,15]heptadec-11(15)-en-8-yl] (2S)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate (PubChem CID 10697908) has the molecular formula C28H29F3O8 and a molecular weight of 550.53 g/mol. Its IUPAC name is [(1R,2S,7S,8R,9S,17S)-7-hydroxy-1,17-dimethyl-12-methylidene-14,16-dioxo-10,13-dioxatetracyclo[7.7.1.02,7.011,15]heptadec-11(15)-en-8-yl] (2S)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate.
| Compound Name | [(1R,2S,7S,8R,9S,17S)-7-hydroxy-1,17-dimethyl-12-methylidene-14,16-dioxo-10,13-dioxatetracyclo[7.7.1.02,7.011,15]heptadec-11(15)-en-8-yl] (2S)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate |
|---|---|
| PubChem CID | 10697908 |
| Molecular Formula | C28H29F3O8 |
| Molecular Weight | 550.53 g/mol |
| Exact Mass | 550.18 |
| IUPAC Name | [(1R,2S,7S,8R,9S,17S)-7-hydroxy-1,17-dimethyl-12-methylidene-14,16-dioxo-10,13-dioxatetracyclo[7.7.1.02,7.011,15]heptadec-11(15)-en-8-yl] (2S)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate |
| SMILES | C=C1OC(=O)C2=C1O[C@@H]1[C@@H](OC(=O)[C@@](OC)(c3ccccc3)C(F)(F)F)[C@]3(O)CCCC[C@H]3[C@](C)(C2=O)[C@@H]1C |
| InChI | InChI=1S/C28H29F3O8/c1-14-19-22(39-24(34)27(36-4,28(29,30)31)16-10-6-5-7-11-16)26(35)13-9-8-12-17(26)25(14,3)21(32)18-20(38-19)15(2)37-23(18)33/h5-7,10-11,14,17,19,22,35H,2,8-9,12-13H2,1,3-4H3/t14-,17+,19+,22-,25-,26+,27+/m1/s1 |
| InChIKey | VPMAUIPWQUSGPA-BRKXFJAMSA-N |
| XLogP | 3.87 |
| TPSA | 108.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.53 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|