C55H63N3O5Si — CID 10700849
2-O-benzyl 1-O-tert-butyl (2S,4S)-4-[[(2R)-3-[tert-butyl(diphenyl)silyl]oxy-2-(tritylamino)propyl]amino]pyrrolidine-1,2-dicarboxylate (PubChem CID 10700849) has the molecular formula C55H63N3O5Si and a molecular weight of 874.21 g/mol. Its IUPAC name is 2-O-benzyl 1-O-tert-butyl (2S,4S)-4-[[(2R)-3-[tert-butyl(diphenyl)silyl]oxy-2-(tritylamino)propyl]amino]pyrrolidine-1,2-dicarboxylate.
| Compound Name | 2-O-benzyl 1-O-tert-butyl (2S,4S)-4-[[(2R)-3-[tert-butyl(diphenyl)silyl]oxy-2-(tritylamino)propyl]amino]pyrrolidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 10700849 |
| Molecular Formula | C55H63N3O5Si |
| Molecular Weight | 874.21 g/mol |
| Exact Mass | 873.45 |
| IUPAC Name | 2-O-benzyl 1-O-tert-butyl (2S,4S)-4-[[(2R)-3-[tert-butyl(diphenyl)silyl]oxy-2-(tritylamino)propyl]amino]pyrrolidine-1,2-dicarboxylate |
| SMILES | CC(C)(C)OC(=O)N1C[C@@H](NC[C@H](CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)NC(c2ccccc2)(c2ccccc2)c2ccccc2)C[C@H]1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C55H63N3O5Si/c1-53(2,3)63-52(60)58-39-46(37-50(58)51(59)61-40-42-25-13-7-14-26-42)56-38-47(41-62-64(54(4,5)6,48-33-21-11-22-34-48)49-35-23-12-24-36-49)57-55(43-27-15-8-16-28-43,44-29-17-9-18-30-44)45-31-19-10-20-32-45/h7-36,46-47,50,56-57H,37-41H2,1-6H3/t46-,47+,50-/m0/s1 |
| InChIKey | PYNZIVKLHVHSNZ-XBQZZULISA-N |
| XLogP | 9.22 |
| TPSA | 89.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 874.21 |
| LogP ≤ 5 | 9.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|