C18H25NO2S2 — CID 10712933
methyl (1R)-1-[di(propan-2-yl)carbamoyloxy]-2,3-dihydroindene-1-carbodithioate (PubChem CID 10712933) has the molecular formula C18H25NO2S2 and a molecular weight of 351.54 g/mol. Its IUPAC name is methyl (1R)-1-[di(propan-2-yl)carbamoyloxy]-2,3-dihydroindene-1-carbodithioate.
| Compound Name | methyl (1R)-1-[di(propan-2-yl)carbamoyloxy]-2,3-dihydroindene-1-carbodithioate |
|---|---|
| PubChem CID | 10712933 |
| Molecular Formula | C18H25NO2S2 |
| Molecular Weight | 351.54 g/mol |
| Exact Mass | 351.13 |
| IUPAC Name | methyl (1R)-1-[di(propan-2-yl)carbamoyloxy]-2,3-dihydroindene-1-carbodithioate |
| SMILES | CSC(=S)[C@@]1(OC(=O)N(C(C)C)C(C)C)CCc2ccccc21 |
| InChI | InChI=1S/C18H25NO2S2/c1-12(2)19(13(3)4)17(20)21-18(16(22)23-5)11-10-14-8-6-7-9-15(14)18/h6-9,12-13H,10-11H2,1-5H3/t18-/m1/s1 |
| InChIKey | UBABDQUUSUUIGJ-GOSISDBHSA-N |
| XLogP | 4.77 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.54 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|