C21H21N3O3S2 — CID 10717383
5-[[2-[(2-cyclohexyl-1,3-thiazol-4-yl)methyl]-1,3-benzoxazol-5-yl]methyl]-1,3-thiazolidine-2,4-dione (PubChem CID 10717383) has the molecular formula C21H21N3O3S2 and a molecular weight of 427.55 g/mol. Its IUPAC name is 5-[[2-[(2-cyclohexyl-1,3-thiazol-4-yl)methyl]-1,3-benzoxazol-5-yl]methyl]-1,3-thiazolidine-2,4-dione.
| Compound Name | 5-[[2-[(2-cyclohexyl-1,3-thiazol-4-yl)methyl]-1,3-benzoxazol-5-yl]methyl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 10717383 |
| Molecular Formula | C21H21N3O3S2 |
| Molecular Weight | 427.55 g/mol |
| Exact Mass | 427.10 |
| IUPAC Name | 5-[[2-[(2-cyclohexyl-1,3-thiazol-4-yl)methyl]-1,3-benzoxazol-5-yl]methyl]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1NC(=O)C(Cc2ccc3oc(Cc4csc(C5CCCCC5)n4)nc3c2)S1 |
| InChI | InChI=1S/C21H21N3O3S2/c25-19-17(29-21(26)24-19)9-12-6-7-16-15(8-12)23-18(27-16)10-14-11-28-20(22-14)13-4-2-1-3-5-13/h6-8,11,13,17H,1-5,9-10H2,(H,24,25,26) |
| InChIKey | BFDNTEFJQZWYAV-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 85.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.55 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|