C22H16N2O3S — CID 10810309
5-[[2-(naphthalen-1-ylmethyl)-1,3-benzoxazol-5-yl]methyl]-1,3-thiazolidine-2,4-dione (PubChem CID 10810309) has the molecular formula C22H16N2O3S and a molecular weight of 388.45 g/mol. Its IUPAC name is 5-[[2-(naphthalen-1-ylmethyl)-1,3-benzoxazol-5-yl]methyl]-1,3-thiazolidine-2,4-dione.
| Compound Name | 5-[[2-(naphthalen-1-ylmethyl)-1,3-benzoxazol-5-yl]methyl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 10810309 |
| Molecular Formula | C22H16N2O3S |
| Molecular Weight | 388.45 g/mol |
| Exact Mass | 388.09 |
| IUPAC Name | 5-[[2-(naphthalen-1-ylmethyl)-1,3-benzoxazol-5-yl]methyl]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1NC(=O)C(Cc2ccc3oc(Cc4cccc5ccccc45)nc3c2)S1 |
| InChI | InChI=1S/C22H16N2O3S/c25-21-19(28-22(26)24-21)11-13-8-9-18-17(10-13)23-20(27-18)12-15-6-3-5-14-4-1-2-7-16(14)15/h1-10,19H,11-12H2,(H,24,25,26) |
| InChIKey | KYLSBGKPVYHNRA-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 72.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.45 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|