C23H48O6Si2 — CID 10719390
butyl (Z,2S,6S)-7-[tert-butyl(dimethyl)silyl]oxy-2-hydroxy-6-(2-trimethylsilylethoxymethoxy)hept-4-enoate (PubChem CID 10719390) has the molecular formula C23H48O6Si2 and a molecular weight of 476.80 g/mol. Its IUPAC name is butyl (Z,2S,6S)-7-[tert-butyl(dimethyl)silyl]oxy-2-hydroxy-6-(2-trimethylsilylethoxymethoxy)hept-4-enoate.
| Compound Name | butyl (Z,2S,6S)-7-[tert-butyl(dimethyl)silyl]oxy-2-hydroxy-6-(2-trimethylsilylethoxymethoxy)hept-4-enoate |
|---|---|
| PubChem CID | 10719390 |
| Molecular Formula | C23H48O6Si2 |
| Molecular Weight | 476.80 g/mol |
| Exact Mass | 476.30 |
| IUPAC Name | butyl (Z,2S,6S)-7-[tert-butyl(dimethyl)silyl]oxy-2-hydroxy-6-(2-trimethylsilylethoxymethoxy)hept-4-enoate |
| SMILES | CCCCOC(=O)[C@@H](O)C/C=C\[C@@H](CO[Si](C)(C)C(C)(C)C)OCOCC[Si](C)(C)C |
| InChI | InChI=1S/C23H48O6Si2/c1-10-11-15-27-22(25)21(24)14-12-13-20(18-29-31(8,9)23(2,3)4)28-19-26-16-17-30(5,6)7/h12-13,20-21,24H,10-11,14-19H2,1-9H3/b13-12-/t20-,21-/m0/s1 |
| InChIKey | IBRNHHDKKPYEFR-WVBBQCPNSA-N |
| XLogP | 5.36 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.80 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|