C20H36O5Si — CID 53483798
[(E,2S)-7-[(3S,6S)-3-[tert-butyl(dimethyl)silyl]oxy-2-hydroxy-3,6-dihydro-2H-pyran-6-yl]hept-6-en-2-yl] acetate (PubChem CID 53483798) has the molecular formula C20H36O5Si and a molecular weight of 384.59 g/mol. Its IUPAC name is [(E,2S)-7-[(3S,6S)-3-[tert-butyl(dimethyl)silyl]oxy-2-hydroxy-3,6-dihydro-2H-pyran-6-yl]hept-6-en-2-yl] acetate.
| Compound Name | [(E,2S)-7-[(3S,6S)-3-[tert-butyl(dimethyl)silyl]oxy-2-hydroxy-3,6-dihydro-2H-pyran-6-yl]hept-6-en-2-yl] acetate |
|---|---|
| PubChem CID | 53483798 |
| Molecular Formula | C20H36O5Si |
| Molecular Weight | 384.59 g/mol |
| Exact Mass | 384.23 |
| IUPAC Name | [(E,2S)-7-[(3S,6S)-3-[tert-butyl(dimethyl)silyl]oxy-2-hydroxy-3,6-dihydro-2H-pyran-6-yl]hept-6-en-2-yl] acetate |
| SMILES | CC(=O)O[C@@H](C)CCC/C=C/[C@H]1C=C[C@H](O[Si](C)(C)C(C)(C)C)C(O)O1 |
| InChI | InChI=1S/C20H36O5Si/c1-15(23-16(2)21)11-9-8-10-12-17-13-14-18(19(22)24-17)25-26(6,7)20(3,4)5/h10,12-15,17-19,22H,8-9,11H2,1-7H3/b12-10+/t15-,17-,18-,19?/m0/s1 |
| InChIKey | ALWKOAIYNKABEW-CZAXFJLLSA-N |
| XLogP | 4.33 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.59 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|